C16H14Cl2N2O3 — CID 7342085
[4-(2,6-dichlorobenzoyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 7342085) has the molecular formula C16H14Cl2N2O3 and a molecular weight of 353.20 g/mol. Its IUPAC name is [4-(2,6-dichlorobenzoyl)piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(2,6-dichlorobenzoyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 7342085 |
| Molecular Formula | C16H14Cl2N2O3 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | [4-(2,6-dichlorobenzoyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H14Cl2N2O3/c17-11-3-1-4-12(18)14(11)16(22)20-8-6-19(7-9-20)15(21)13-5-2-10-23-13/h1-5,10H,6-9H2 |
| InChIKey | MKYABGGONWNRHE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |