C18H25N3O4 — CID 108958407
1-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione (PubChem CID 108958407) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione.
| Compound Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 108958407 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-pyrrolidin-1-ylpropane-1,3-dione |
| SMILES | CC(C)(C(=O)N1CCCC1)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-18(2,16(23)20-7-3-4-8-20)17(24)21-11-9-19(10-12-21)15(22)14-6-5-13-25-14/h5-6,13H,3-4,7-12H2,1-2H3 |
| InChIKey | PEGQBKGPIJNQBL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|