C21H25N3O4 — CID 108965538
3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-N-(3-methylphenyl)-3-oxopropanamide (PubChem CID 108965538) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-N-(3-methylphenyl)-3-oxopropanamide.
| Compound Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-N-(3-methylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108965538 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-N-(3-methylphenyl)-3-oxopropanamide |
| SMILES | Cc1cccc(NC(=O)C(C)(C)C(=O)N2CCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-15-6-4-7-16(14-15)22-19(26)21(2,3)20(27)24-11-9-23(10-12-24)18(25)17-8-5-13-28-17/h4-8,13-14H,9-12H2,1-3H3,(H,22,26) |
| InChIKey | MMEMVVJUHGZAPI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|