C20H24N4O4 — CID 108963516
3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 108963516) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 108963516 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | CC(C)(C(=O)NCc1cccnc1)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H24N4O4/c1-20(2,18(26)22-14-15-5-3-7-21-13-15)19(27)24-10-8-23(9-11-24)17(25)16-6-4-12-28-16/h3-7,12-13H,8-11,14H2,1-2H3,(H,22,26) |
| InChIKey | AYWKSQKUELRLJN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|