C17H19N3O3 — CID 32618175
(3R)-1-(furan-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 32618175) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is (3R)-1-(furan-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(furan-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 32618175 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (3R)-1-(furan-2-carbonyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)[C@@H]1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C17H19N3O3/c21-16(19-11-13-4-1-7-18-10-13)14-5-2-8-20(12-14)17(22)15-6-3-9-23-15/h1,3-4,6-7,9-10,14H,2,5,8,11-12H2,(H,19,21)/t14-/m1/s1 |
| InChIKey | PZOMLNXXZBIPMN-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |