C16H22N2O4 — CID 34750702
(3R)-1-(furan-2-carbonyl)-N-[[(2R)-oxolan-2-yl]methyl]piperidine-3-carboxamide (PubChem CID 34750702) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3R)-1-(furan-2-carbonyl)-N-[[(2R)-oxolan-2-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-(furan-2-carbonyl)-N-[[(2R)-oxolan-2-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 34750702 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3R)-1-(furan-2-carbonyl)-N-[[(2R)-oxolan-2-yl]methyl]piperidine-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)[C@@H]1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C16H22N2O4/c19-15(17-10-13-5-2-8-21-13)12-4-1-7-18(11-12)16(20)14-6-3-9-22-14/h3,6,9,12-13H,1-2,4-5,7-8,10-11H2,(H,17,19)/t12-,13-/m1/s1 |
| InChIKey | UDLABYIYMNWESH-CHWSQXEVSA-N |
| XLogP | 1.43 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |