C23H31N3O3 — CID 46529020
N-[2-(diethylamino)-2-phenylethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide (PubChem CID 46529020) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46529020 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)C1CCCN(C(=O)c2ccco2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3/c1-3-25(4-2)20(18-10-6-5-7-11-18)16-24-22(27)19-12-8-14-26(17-19)23(28)21-13-9-15-29-21/h5-7,9-11,13,15,19-20H,3-4,8,12,14,16-17H2,1-2H3,(H,24,27) |
| InChIKey | AQKNEVMKJOBBBR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |