C24H33N3O2S — CID 55660182
N-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide (PubChem CID 55660182) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55660182 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-1-(4-methylbenzoyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)C1CCCN(C(=O)c2ccc(C)cc2)C1)c1ccsc1 |
| InChI | InChI=1S/C24H33N3O2S/c1-4-26(5-2)22(21-12-14-30-17-21)15-25-23(28)20-7-6-13-27(16-20)24(29)19-10-8-18(3)9-11-19/h8-12,14,17,20,22H,4-7,13,15-16H2,1-3H3,(H,25,28) |
| InChIKey | RSFJXWMZMOUSJM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |