C18H27F3N2OS — CID 60510595
N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 60510595) has the molecular formula C18H27F3N2OS and a molecular weight of 376.49 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60510595 |
| Molecular Formula | C18H27F3N2OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)C1CCCC(C(F)(F)F)C1)c1ccsc1 |
| InChI | InChI=1S/C18H27F3N2OS/c1-3-23(4-2)16(14-8-9-25-12-14)11-22-17(24)13-6-5-7-15(10-13)18(19,20)21/h8-9,12-13,15-16H,3-7,10-11H2,1-2H3,(H,22,24) |
| InChIKey | FIGDHQMRHAVCHE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |