C20H31N3O2 — CID 51941120
(3R)-1-N,1-N-diethyl-3-N-[(2R)-2-phenylpropyl]piperidine-1,3-dicarboxamide (PubChem CID 51941120) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (3R)-1-N,1-N-diethyl-3-N-[(2R)-2-phenylpropyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N,1-N-diethyl-3-N-[(2R)-2-phenylpropyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51941120 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (3R)-1-N,1-N-diethyl-3-N-[(2R)-2-phenylpropyl]piperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCC[C@@H](C(=O)NC[C@H](C)c2ccccc2)C1 |
| InChI | InChI=1S/C20H31N3O2/c1-4-22(5-2)20(25)23-13-9-12-18(15-23)19(24)21-14-16(3)17-10-7-6-8-11-17/h6-8,10-11,16,18H,4-5,9,12-15H2,1-3H3,(H,21,24)/t16-,18+/m0/s1 |
| InChIKey | XMXWXZAWXXTBLH-FUHWJXTLSA-N |
| XLogP | 3.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |