C24H31N3OS — CID 3785270
1-(benzhydrylcarbamothioyl)-N,N-diethylpiperidine-3-carboxamide (PubChem CID 3785270) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is 1-(benzhydrylcarbamothioyl)-N,N-diethylpiperidine-3-carboxamide.
| Compound Name | 1-(benzhydrylcarbamothioyl)-N,N-diethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3785270 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-(benzhydrylcarbamothioyl)-N,N-diethylpiperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=S)NC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H31N3OS/c1-3-26(4-2)23(28)21-16-11-17-27(18-21)24(29)25-22(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-10,12-15,21-22H,3-4,11,16-18H2,1-2H3,(H,25,29) |
| InChIKey | FABMUQBEXAWLMJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|