C17H21F3N2O2 — CID 110344215
N-benzyl-N-ethyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide (PubChem CID 110344215) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide.
| Compound Name | N-benzyl-N-ethyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110344215 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-benzyl-N-ethyl-1-(2,2,2-trifluoroacetyl)piperidine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CCCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-2-21(11-13-7-4-3-5-8-13)15(23)14-9-6-10-22(12-14)16(24)17(18,19)20/h3-5,7-8,14H,2,6,9-12H2,1H3 |
| InChIKey | KHXDJJUINCGNSF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |