C25H33N3O2 — CID 55629106
N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55629106) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55629106 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N-ethyl-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | CCN(Cc1ccc(N(C)C)cc1)C(=O)C1CCCN(C(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H33N3O2/c1-4-27(18-21-12-14-23(15-13-21)26(2)3)25(30)22-11-8-16-28(19-22)24(29)17-20-9-6-5-7-10-20/h5-7,9-10,12-15,22H,4,8,11,16-19H2,1-3H3 |
| InChIKey | LQZFYBVGXWOCEY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|