C18H25FN2O2 — CID 94028091
(3S)-N,N-diethyl-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide (PubChem CID 94028091) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is (3S)-N,N-diethyl-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N,N-diethyl-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94028091 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (3S)-N,N-diethyl-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN(C(=O)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H25FN2O2/c1-3-20(4-2)18(23)15-6-5-11-21(13-15)17(22)12-14-7-9-16(19)10-8-14/h7-10,15H,3-6,11-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | MCOFIGHZRFPDIN-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |