C22H23F2N3O3 — CID 55738620
N',1-bis[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide (PubChem CID 55738620) has the molecular formula C22H23F2N3O3 and a molecular weight of 415.44 g/mol. Its IUPAC name is N',1-bis[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide.
| Compound Name | N',1-bis[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55738620 |
| Molecular Formula | C22H23F2N3O3 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N',1-bis[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)C1CCCN(C(=O)Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H23F2N3O3/c23-18-7-3-15(4-8-18)12-20(28)25-26-22(30)17-2-1-11-27(14-17)21(29)13-16-5-9-19(24)10-6-16/h3-10,17H,1-2,11-14H2,(H,25,28)(H,26,30) |
| InChIKey | PPWAWALBSCKJSI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|