C19H19BrFN3O3S — CID 55738685
N'-(5-bromothiophene-2-carbonyl)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide (PubChem CID 55738685) has the molecular formula C19H19BrFN3O3S and a molecular weight of 468.35 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 55738685 |
| Molecular Formula | C19H19BrFN3O3S |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(C(=O)Cc2ccc(F)cc2)C1)c1ccc(Br)s1 |
| InChI | InChI=1S/C19H19BrFN3O3S/c20-16-8-7-15(28-16)19(27)23-22-18(26)13-2-1-9-24(11-13)17(25)10-12-3-5-14(21)6-4-12/h3-8,13H,1-2,9-11H2,(H,22,26)(H,23,27) |
| InChIKey | NSWGQDXUVRNSEF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|