C9H9BrN2O2S — CID 26662526
5-bromo-N'-(cyclopropanecarbonyl)thiophene-2-carbohydrazide (PubChem CID 26662526) has the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. Its IUPAC name is 5-bromo-N'-(cyclopropanecarbonyl)thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(cyclopropanecarbonyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 26662526 |
| Molecular Formula | C9H9BrN2O2S |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 5-bromo-N'-(cyclopropanecarbonyl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H9BrN2O2S/c10-7-4-3-6(15-7)9(14)12-11-8(13)5-1-2-5/h3-5H,1-2H2,(H,11,13)(H,12,14) |
| InChIKey | DCGAKAMZLPCEDW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|