C11H13BrN2O4S2 — CID 9154758
5-bromo-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]thiophene-2-carbohydrazide (PubChem CID 9154758) has the molecular formula C11H13BrN2O4S2 and a molecular weight of 381.27 g/mol. Its IUPAC name is 5-bromo-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9154758 |
| Molecular Formula | C11H13BrN2O4S2 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 5-bromo-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H13BrN2O4S2/c12-9-2-1-8(19-9)11(16)14-13-10(15)5-7-3-4-20(17,18)6-7/h1-2,7H,3-6H2,(H,13,15)(H,14,16)/t7-/m0/s1 |
| InChIKey | LUKGRKAWPAUZLT-ZETCQYMHSA-N |
| XLogP | 1.10 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|