C20H20N2O5S — CID 8938593
2-benzoyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide (PubChem CID 8938593) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-benzoyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide.
| Compound Name | 2-benzoyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8938593 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-benzoyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)NNC(=O)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O5S/c23-18(12-14-10-11-28(26,27)13-14)21-22-20(25)17-9-5-4-8-16(17)19(24)15-6-2-1-3-7-15/h1-9,14H,10-13H2,(H,21,23)(H,22,25)/t14-/m1/s1 |
| InChIKey | FPFUXHDPTXUHRE-CQSZACIVSA-N |
| XLogP | 1.50 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|