C18H22N2O6S — CID 8559345
[2-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate (PubChem CID 8559345) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is [2-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate.
| Compound Name | [2-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8559345 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-[2-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2)CC1)NNC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H22N2O6S/c21-15(10-13-6-9-27(24,25)12-13)19-20-16(22)11-26-17(23)18(7-8-18)14-4-2-1-3-5-14/h1-5,13H,6-12H2,(H,19,21)(H,20,22)/t13-/m1/s1 |
| InChIKey | TVEKGOAVBQLHAF-CYBMUJFWSA-N |
| XLogP | 0.23 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|