C14H17FN2O5S — CID 8938962
2-[(3S)-1,1-dioxothiolan-3-yl]-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide (PubChem CID 8938962) has the molecular formula C14H17FN2O5S and a molecular weight of 344.36 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 8938962 |
| Molecular Formula | C14H17FN2O5S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N'-[2-(2-fluorophenoxy)acetyl]acetohydrazide |
| SMILES | O=C(COc1ccccc1F)NNC(=O)C[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17FN2O5S/c15-11-3-1-2-4-12(11)22-8-14(19)17-16-13(18)7-10-5-6-23(20,21)9-10/h1-4,10H,5-9H2,(H,16,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | CANFUUWQFNEEGY-SNVBAGLBSA-N |
| XLogP | 0.18 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|