C16H22N2O5S — CID 55395780
N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide (PubChem CID 55395780) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide.
| Compound Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide |
|---|---|
| PubChem CID | 55395780 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N'-[2-(2,5-dimethylphenoxy)acetyl]-2-(1,1-dioxothiolan-3-yl)acetohydrazide |
| SMILES | Cc1ccc(C)c(OCC(=O)NNC(=O)CC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C16H22N2O5S/c1-11-3-4-12(2)14(7-11)23-9-16(20)18-17-15(19)8-13-5-6-24(21,22)10-13/h3-4,7,13H,5-6,8-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | LVYNTXNYYHMXGR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|