C14H16ClFN2O5S — CID 8939667
N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide (PubChem CID 8939667) has the molecular formula C14H16ClFN2O5S and a molecular weight of 378.81 g/mol. Its IUPAC name is N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide.
| Compound Name | N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 8939667 |
| Molecular Formula | C14H16ClFN2O5S |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N'-[2-(2-chloro-4-fluorophenoxy)acetyl]-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
| SMILES | O=C(COc1ccc(F)cc1Cl)NNC(=O)C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16ClFN2O5S/c15-11-6-10(16)1-2-12(11)23-7-14(20)18-17-13(19)5-9-3-4-24(21,22)8-9/h1-2,6,9H,3-5,7-8H2,(H,17,19)(H,18,20)/t9-/m0/s1 |
| InChIKey | UFVIXDXFZABHIT-VIFPVBQESA-N |
| XLogP | 0.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|