C15H14ClFN2O4S2 — CID 8938864
3-chloro-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-6-fluoro-1-benzothiophene-2-carbohydrazide (PubChem CID 8938864) has the molecular formula C15H14ClFN2O4S2 and a molecular weight of 404.87 g/mol. Its IUPAC name is 3-chloro-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-6-fluoro-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-6-fluoro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 8938864 |
| Molecular Formula | C15H14ClFN2O4S2 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 3-chloro-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]-6-fluoro-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C15H14ClFN2O4S2/c16-13-10-2-1-9(17)6-11(10)24-14(13)15(21)19-18-12(20)5-8-3-4-25(22,23)7-8/h1-2,6,8H,3-5,7H2,(H,18,20)(H,19,21)/t8-/m0/s1 |
| InChIKey | HUYTWLYPZMGIEP-QMMMGPOBSA-N |
| XLogP | 2.28 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|