C12H13F2NO3S — CID 9209582
N-(2,4-difluorophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 9209582) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 9209582 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2NO3S/c13-9-1-2-11(10(14)6-9)15-12(16)5-8-3-4-19(17,18)7-8/h1-2,6,8H,3-5,7H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | OOLNRWNZKZVNTD-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |