C13H16BrNO3S — CID 43806574
N-(5-bromo-2-methylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 43806574) has the molecular formula C13H16BrNO3S and a molecular weight of 346.25 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 43806574 |
| Molecular Formula | C13H16BrNO3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16BrNO3S/c1-9-2-3-11(14)7-12(9)15-13(16)6-10-4-5-19(17,18)8-10/h2-3,7,10H,4-6,8H2,1H3,(H,15,16) |
| InChIKey | XLDOBKCEOZLLGV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |