C11H13BrN2O3S — CID 60712565
N-(5-bromo-2-pyridinyl)-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 60712565) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 60712565 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H13BrN2O3S/c12-9-1-2-10(13-6-9)14-11(15)5-8-3-4-18(16,17)7-8/h1-2,6,8H,3-5,7H2,(H,13,14,15) |
| InChIKey | QDPKABHBSAWECX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |