C16H23N3O3S — CID 71943578
2-(1,1-dioxothiolan-3-yl)-N-(6-piperidin-1-yl-3-pyridinyl)acetamide (PubChem CID 71943578) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-(6-piperidin-1-yl-3-pyridinyl)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-(6-piperidin-1-yl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 71943578 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-(6-piperidin-1-yl-3-pyridinyl)acetamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)Nc1ccc(N2CCCCC2)nc1 |
| InChI | InChI=1S/C16H23N3O3S/c20-16(10-13-6-9-23(21,22)12-13)18-14-4-5-15(17-11-14)19-7-2-1-3-8-19/h4-5,11,13H,1-3,6-10,12H2,(H,18,20) |
| InChIKey | STIZCUIXOPRDEJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |