C13H16N2O4S — CID 9207165
4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzamide (PubChem CID 9207165) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9207165 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H16N2O4S/c14-13(17)10-1-3-11(4-2-10)15-12(16)7-9-5-6-20(18,19)8-9/h1-4,9H,5-8H2,(H2,14,17)(H,15,16)/t9-/m0/s1 |
| InChIKey | URHQVWCYGVBLKR-VIFPVBQESA-N |
| XLogP | 0.55 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |