C13H16N2O4S2 — CID 9044427
4-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]benzamide (PubChem CID 9044427) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 9044427 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CS[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H16N2O4S2/c14-13(17)9-1-3-10(4-2-9)15-12(16)7-20-11-5-6-21(18,19)8-11/h1-4,11H,5-8H2,(H2,14,17)(H,15,16)/t11-/m1/s1 |
| InChIKey | BOUNSSWZGFAKBO-LLVKDONJSA-N |
| XLogP | 0.64 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |