C14H19NO4S2 — CID 9043135
2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide (PubChem CID 9043135) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9043135 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CS[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H19NO4S2/c1-2-19-12-5-3-11(4-6-12)15-14(16)9-20-13-7-8-21(17,18)10-13/h3-6,13H,2,7-10H2,1H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | CBBGYWLFYYHOMV-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |