C13H17NO4S2 — CID 9042272
2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-methoxyphenyl)acetamide (PubChem CID 9042272) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9042272 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]sulfanyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CS[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO4S2/c1-18-11-4-2-10(3-5-11)14-13(15)8-19-12-6-7-20(16,17)9-12/h2-5,12H,6-9H2,1H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | SPZRHLOMCCGBTB-LBPRGKRZSA-N |
| XLogP | 1.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |