C17H23NO5S — CID 7223083
butyl 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzoate (PubChem CID 7223083) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is butyl 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7223083 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | butyl 4-[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-2-3-9-23-17(20)14-4-6-15(7-5-14)18-16(19)11-13-8-10-24(21,22)12-13/h4-7,13H,2-3,8-12H2,1H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | CTXFKMOJUSGMSO-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|