C17H24N2O5S — CID 55365307
butyl 4-[[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]amino]benzoate (PubChem CID 55365307) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is butyl 4-[[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 55365307 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | butyl 4-[[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NCC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-2-3-9-24-17(21)13-4-6-14(7-5-13)18-11-16(20)19-15-8-10-25(22,23)12-15/h4-7,15,18H,2-3,8-12H2,1H3,(H,19,20) |
| InChIKey | MIBAALQHZHHEGW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|