C19H27N3O4 — CID 26507517
butyl 4-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzoate (PubChem CID 26507517) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is butyl 4-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzoate |
|---|---|
| PubChem CID | 26507517 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | butyl 4-[[2-(cyclopentylcarbamoylamino)-2-oxoethyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NCC(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C19H27N3O4/c1-2-3-12-26-18(24)14-8-10-15(11-9-14)20-13-17(23)22-19(25)21-16-6-4-5-7-16/h8-11,16,20H,2-7,12-13H2,1H3,(H2,21,22,23,25) |
| InChIKey | LACIVIRNTULCOE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|