C19H19NO6S — CID 2646618
[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-phenoxybenzoate (PubChem CID 2646618) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-phenoxybenzoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-phenoxybenzoate |
|---|---|
| PubChem CID | 2646618 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] 4-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(Oc2ccccc2)cc1)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H19NO6S/c21-18(20-15-10-11-27(23,24)13-15)12-25-19(22)14-6-8-17(9-7-14)26-16-4-2-1-3-5-16/h1-9,15H,10-13H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | DURCODPYQCEHLW-OAHLLOKOSA-N |
| XLogP | 1.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |