C17H23NO5S — CID 52517818
N-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-4-(4-propoxyphenyl)butanamide (PubChem CID 52517818) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-4-(4-propoxyphenyl)butanamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-4-(4-propoxyphenyl)butanamide |
|---|---|
| PubChem CID | 52517818 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-4-oxo-4-(4-propoxyphenyl)butanamide |
| SMILES | CCCOc1ccc(C(=O)CCC(=O)N[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-2-10-23-15-5-3-13(4-6-15)16(19)7-8-17(20)18-14-9-11-24(21,22)12-14/h3-6,14H,2,7-12H2,1H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | DANSKXHDQRZAMM-CQSZACIVSA-N |
| XLogP | 1.74 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |