C19H29ClN2O3 — CID 119453244
4-oxo-4-(4-pentoxyphenyl)-N-pyrrolidin-3-ylbutanamide;hydrochloride (PubChem CID 119453244) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is 4-oxo-4-(4-pentoxyphenyl)-N-pyrrolidin-3-ylbutanamide;hydrochloride.
| Compound Name | 4-oxo-4-(4-pentoxyphenyl)-N-pyrrolidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119453244 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 4-oxo-4-(4-pentoxyphenyl)-N-pyrrolidin-3-ylbutanamide;hydrochloride |
| SMILES | CCCCCOc1ccc(C(=O)CCC(=O)NC2CCNC2)cc1.Cl |
| InChI | InChI=1S/C19H28N2O3.ClH/c1-2-3-4-13-24-17-7-5-15(6-8-17)18(22)9-10-19(23)21-16-11-12-20-14-16;/h5-8,16,20H,2-4,9-14H2,1H3,(H,21,23);1H |
| InChIKey | XMBLVXWPFSONHG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|