C16H25ClN2O4S — CID 119451061
5-(4-methylsulfonylphenoxy)-N-pyrrolidin-3-ylpentanamide;hydrochloride (PubChem CID 119451061) has the molecular formula C16H25ClN2O4S and a molecular weight of 376.91 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenoxy)-N-pyrrolidin-3-ylpentanamide;hydrochloride.
| Compound Name | 5-(4-methylsulfonylphenoxy)-N-pyrrolidin-3-ylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119451061 |
| Molecular Formula | C16H25ClN2O4S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-(4-methylsulfonylphenoxy)-N-pyrrolidin-3-ylpentanamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(OCCCCC(=O)NC2CCNC2)cc1.Cl |
| InChI | InChI=1S/C16H24N2O4S.ClH/c1-23(20,21)15-7-5-14(6-8-15)22-11-3-2-4-16(19)18-13-9-10-17-12-13;/h5-8,13,17H,2-4,9-12H2,1H3,(H,18,19);1H |
| InChIKey | CVPZZRQSIITIKW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|