C18H29ClN2O4S — CID 119475958
N-(4-aminocyclohexyl)-5-(4-methylsulfonylphenoxy)pentanamide;hydrochloride (PubChem CID 119475958) has the molecular formula C18H29ClN2O4S and a molecular weight of 404.96 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-(4-methylsulfonylphenoxy)pentanamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-5-(4-methylsulfonylphenoxy)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119475958 |
| Molecular Formula | C18H29ClN2O4S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-(4-methylsulfonylphenoxy)pentanamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(OCCCCC(=O)NC2CCC(N)CC2)cc1.Cl |
| InChI | InChI=1S/C18H28N2O4S.ClH/c1-25(22,23)17-11-9-16(10-12-17)24-13-3-2-4-18(21)20-15-7-5-14(19)6-8-15;/h9-12,14-15H,2-8,13,19H2,1H3,(H,20,21);1H |
| InChIKey | ZSWHZCVQFHMISP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|