C12H17NO6S2 — CID 56800043
N-methylsulfonyl-4-(4-methylsulfonylphenoxy)butanamide (PubChem CID 56800043) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is N-methylsulfonyl-4-(4-methylsulfonylphenoxy)butanamide.
| Compound Name | N-methylsulfonyl-4-(4-methylsulfonylphenoxy)butanamide |
|---|---|
| PubChem CID | 56800043 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-methylsulfonyl-4-(4-methylsulfonylphenoxy)butanamide |
| SMILES | CS(=O)(=O)NC(=O)CCCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H17NO6S2/c1-20(15,16)11-7-5-10(6-8-11)19-9-3-4-12(14)13-21(2,17)18/h5-8H,3-4,9H2,1-2H3,(H,13,14) |
| InChIKey | APXDTQAWIRPQCX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|