C16H25NO4S — CID 94813249
N-[(2S)-3-methylbutan-2-yl]-4-(4-methylsulfonylphenoxy)butanamide (PubChem CID 94813249) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[(2S)-3-methylbutan-2-yl]-4-(4-methylsulfonylphenoxy)butanamide.
| Compound Name | N-[(2S)-3-methylbutan-2-yl]-4-(4-methylsulfonylphenoxy)butanamide |
|---|---|
| PubChem CID | 94813249 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[(2S)-3-methylbutan-2-yl]-4-(4-methylsulfonylphenoxy)butanamide |
| SMILES | CC(C)[C@H](C)NC(=O)CCCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H25NO4S/c1-12(2)13(3)17-16(18)6-5-11-21-14-7-9-15(10-8-14)22(4,19)20/h7-10,12-13H,5-6,11H2,1-4H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | WFDBJMSOLJQEGN-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|