C23H29NO6S — CID 97251004
methyl (4S)-4-[4-(4-methylsulfonylphenoxy)butanoylamino]-5-phenylpentanoate (PubChem CID 97251004) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is methyl (4S)-4-[4-(4-methylsulfonylphenoxy)butanoylamino]-5-phenylpentanoate.
| Compound Name | methyl (4S)-4-[4-(4-methylsulfonylphenoxy)butanoylamino]-5-phenylpentanoate |
|---|---|
| PubChem CID | 97251004 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | methyl (4S)-4-[4-(4-methylsulfonylphenoxy)butanoylamino]-5-phenylpentanoate |
| SMILES | COC(=O)CC[C@@H](Cc1ccccc1)NC(=O)CCCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H29NO6S/c1-29-23(26)15-10-19(17-18-7-4-3-5-8-18)24-22(25)9-6-16-30-20-11-13-21(14-12-20)31(2,27)28/h3-5,7-8,11-14,19H,6,9-10,15-17H2,1-2H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | XFFZFBNBVQFRML-IBGZPJMESA-N |
| XLogP | 2.93 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|