C17H27NO4S — CID 95149631
N-[(3R)-2-methylpentan-3-yl]-4-(4-methylsulfonylphenoxy)butanamide (PubChem CID 95149631) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is N-[(3R)-2-methylpentan-3-yl]-4-(4-methylsulfonylphenoxy)butanamide.
| Compound Name | N-[(3R)-2-methylpentan-3-yl]-4-(4-methylsulfonylphenoxy)butanamide |
|---|---|
| PubChem CID | 95149631 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[(3R)-2-methylpentan-3-yl]-4-(4-methylsulfonylphenoxy)butanamide |
| SMILES | CC[C@@H](NC(=O)CCCOc1ccc(S(C)(=O)=O)cc1)C(C)C |
| InChI | InChI=1S/C17H27NO4S/c1-5-16(13(2)3)18-17(19)7-6-12-22-14-8-10-15(11-9-14)23(4,20)21/h8-11,13,16H,5-7,12H2,1-4H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | HOYLSBLNJMSHDW-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|