C16H23NO6S — CID 119198017
2-[4-(4-methylsulfonylphenoxy)butanoyl-propan-2-ylamino]acetic acid (PubChem CID 119198017) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-[4-(4-methylsulfonylphenoxy)butanoyl-propan-2-ylamino]acetic acid.
| Compound Name | 2-[4-(4-methylsulfonylphenoxy)butanoyl-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 119198017 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-(4-methylsulfonylphenoxy)butanoyl-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CC(=O)O)C(=O)CCCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H23NO6S/c1-12(2)17(11-16(19)20)15(18)5-4-10-23-13-6-8-14(9-7-13)24(3,21)22/h6-9,12H,4-5,10-11H2,1-3H3,(H,19,20) |
| InChIKey | FZOYZQCVTRAIGC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|