C14H19NO6S — CID 119358763
2-[methyl-[3-(4-methylsulfonylphenoxy)propanoyl]amino]propanoic acid (PubChem CID 119358763) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[methyl-[3-(4-methylsulfonylphenoxy)propanoyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[3-(4-methylsulfonylphenoxy)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119358763 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[methyl-[3-(4-methylsulfonylphenoxy)propanoyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)CCOc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19NO6S/c1-10(14(17)18)15(2)13(16)8-9-21-11-4-6-12(7-5-11)22(3,19)20/h4-7,10H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | ZMHZUNCXCSRUIU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |