C17H25NO6S — CID 122111798
2-methyl-3-[methyl-[5-(4-methylsulfonylphenoxy)pentanoyl]amino]propanoic acid (PubChem CID 122111798) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[5-(4-methylsulfonylphenoxy)pentanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[5-(4-methylsulfonylphenoxy)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122111798 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-methyl-3-[methyl-[5-(4-methylsulfonylphenoxy)pentanoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)CCCCOc1ccc(S(C)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C17H25NO6S/c1-13(17(20)21)12-18(2)16(19)6-4-5-11-24-14-7-9-15(10-8-14)25(3,22)23/h7-10,13H,4-6,11-12H2,1-3H3,(H,20,21) |
| InChIKey | SUNPOSVILNMWES-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|