C15H22N2O6S2 — CID 122111818
2-methyl-3-[methyl-[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]propanoic acid (PubChem CID 122111818) has the molecular formula C15H22N2O6S2 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122111818 |
| Molecular Formula | C15H22N2O6S2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-methyl-3-[methyl-[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)CSCCOc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O6S2/c1-11(15(19)20)9-17(2)14(18)10-24-8-7-23-12-3-5-13(6-4-12)25(16,21)22/h3-6,11H,7-10H2,1-2H3,(H,19,20)(H2,16,21,22) |
| InChIKey | IAGQHFYZDNJEJS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|