C12H16N2O6S2 — CID 119349966
2-[[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]acetic acid (PubChem CID 119349966) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119349966 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 2-[[2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetyl]amino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(OCCSCC(=O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C12H16N2O6S2/c13-22(18,19)10-3-1-9(2-4-10)20-5-6-21-8-11(15)14-7-12(16)17/h1-4H,5-8H2,(H,14,15)(H,16,17)(H2,13,18,19) |
| InChIKey | MLWJJAZJYHPWJV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|