C15H24ClN3O4S2 — CID 119615675
N-(2-amino-1-cyclopropylethyl)-2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetamide;hydrochloride (PubChem CID 119615675) has the molecular formula C15H24ClN3O4S2 and a molecular weight of 409.96 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119615675 |
| Molecular Formula | C15H24ClN3O4S2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2-[2-(4-sulfamoylphenoxy)ethylsulfanyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)CSCCOc1ccc(S(N)(=O)=O)cc1)C1CC1 |
| InChI | InChI=1S/C15H23N3O4S2.ClH/c16-9-14(11-1-2-11)18-15(19)10-23-8-7-22-12-3-5-13(6-4-12)24(17,20)21;/h3-6,11,14H,1-2,7-10,16H2,(H,18,19)(H2,17,20,21);1H |
| InChIKey | YQYNHRRGJBISHY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|